Introduction：Basic information about CAS 27854-30-4|2h,2h,3h,3h-perfluorononanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2h,2h,3h,3h-perfluorononanoic acid |
|---|
| CAS Number | 27854-30-4 | Molecular Weight | 392.114 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 214.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5F13O2 | Melting Point | 62ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 83.5±25.9 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 214.5±35.0 °C at 760 mmHg |
|---|
| Melting Point | 62ºC |
|---|
| Molecular Formula | C9H5F13O2 |
|---|
| Molecular Weight | 392.114 |
|---|
| Flash Point | 83.5±25.9 °C |
|---|
| Exact Mass | 392.008209 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 5.08 |
|---|
| Vapour Pressure | 0.1±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.313 |
|---|
| InChIKey | AAEJJSZYNKXKSW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2H,2H,3H,3H-perfluoronanoic acid |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-1-oic acid |
| 3-Perfluorhexyl-propionsaeure |
| 3-perfluorohexylpropanoic acid |
| MFCD00077579 |
| Nonanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro- |
| 3-(perfluorohexyl)propionic acid |
| 3-(perfluorohexy)propionic acid |
| 2H,2H,3H,3H-Perfluorononanoic acid |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononanoic acid |
