Introduction：Basic information about CAS 6201-86-1|3-amino-5-sulfosalicylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-5-sulfosalicylic acid |
|---|
| CAS Number | 6201-86-1 | Molecular Weight | 233.19900 |
|---|
| Density | 1.858g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H7NO6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-amino-2-hydroxy-5-sulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.858g/cm3 |
|---|
| Molecular Formula | C7H7NO6S |
|---|
| Molecular Weight | 233.19900 |
|---|
| Exact Mass | 232.99900 |
|---|
| PSA | 146.30000 |
|---|
| LogP | 1.58130 |
|---|
| Index of Refraction | 1.7 |
|---|
| InChIKey | ZLTOYIGWKLTQBJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(S(=O)(=O)O)cc(C(=O)O)c1O |
|---|
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
|---|
Safety Information
Customs
| HS Code | 2922509090 |
|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Amino-5-sulfo-salicylsaeure |
| 3-Amino-2-oxy-benzoesaeure-sulfonsaeure-(5) |
| MFCD00035912 |
| 3-amino-2-hydroxy-5-sulfo-benzoic acid |
| 3-amino-5-sulfo salicylic acid |
| 3-Amino-salicylsaeure-sulfonsaeure-(5) |
| EINECS 228-261-8 |
| 3-Amino-5-sulphosalicylic acid |
| 3-Amino-2-hydroxy-5-sulfo-benzoesaeure |
| 3-Amino-5-sulfosalicyic acid |
