Introduction:Basic information about CAS 24900-79-6|3-Chloro-4-(4-chlorophenoxy)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-(4-chlorophenoxy)aniline |
|---|
| CAS Number | 24900-79-6 | Molecular Weight | 254.112 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 364.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9Cl2NO | Melting Point | 73-77 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 174.4±26.5 °C |
|---|
Names
| Name | 3-chloro-4-(4-chlorophenoxy)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 364.7±37.0 °C at 760 mmHg |
|---|
| Melting Point | 73-77 °C(lit.) |
|---|
| Molecular Formula | C12H9Cl2NO |
|---|
| Molecular Weight | 254.112 |
|---|
| Flash Point | 174.4±26.5 °C |
|---|
| Exact Mass | 253.006119 |
|---|
| PSA | 35.25000 |
|---|
| LogP | 3.62 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | OQOCWFFSZSSEDS-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Aniline, 3-chloro-4-(p-chlorophenoxy)- |
| Benzenamine, 3-chloro-4-(4-chlorophenoxy)- |
| 2-Chlor-4-amino-phenol-(4-chlor-phenylaether) |
| 2,3-DIFLUOROBENZYL MERCAPTAN |
| 3-chloro-4-(4-chloro-phenoxy)-aniline |
| 3-chloro-4-(4-chlorophenoxy)-benzenamine |
| EINECS 246-519-8 |
| 3-Chlor-4-(4-chlor-phenoxy)-anilin |
| 4-(4'-chlorophenoxy)-3-chloroaniline |
| 2.4'-Dichlor-4-amino-diphenyl-aether |
| 3-Chloro-4-(4-chlorophenoxy)aniline |
| MFCD00459649 |