Introduction:Basic information about CAS 72807-18-2|1-(1h-indol-3-ylmethyl)piperidin-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(1h-indol-3-ylmethyl)piperidin-4-amine |
|---|
| CAS Number | 72807-18-2 | Molecular Weight | 229.32100 |
|---|
| Density | 1.171g/cm3 | Boiling Point | 397.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.4ºC |
|---|
Names
| Name | 1-(1h-indol-3-ylmethyl)piperidin-4-amine |
|---|
Chemical & Physical Properties
| Density | 1.171g/cm3 |
|---|
| Boiling Point | 397.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19N3 |
|---|
| Molecular Weight | 229.32100 |
|---|
| Flash Point | 194.4ºC |
|---|
| Exact Mass | 229.15800 |
|---|
| PSA | 45.05000 |
|---|
| LogP | 2.72920 |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | VKEURNDOWDDXJE-UHFFFAOYSA-N |
|---|
| SMILES | NC1CCN(Cc2c[nH]c3ccccc23)CC1 |
|---|