Introduction：Basic information about CAS 60833-82-1|Bz-Arg-4-Abz-OH hydrochloride salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bz-Arg-4-Abz-OH hydrochloride salt |
|---|
| CAS Number | 60833-82-1 | Molecular Weight | 397.42800 |
|---|
| Density | 1.35g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C20H23N5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[[(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoyl]amino]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Molecular Formula | C20H23N5O4 |
|---|
| Molecular Weight | 397.42800 |
|---|
| Exact Mass | 397.17500 |
|---|
| PSA | 157.40000 |
|---|
| LogP | 3.04000 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | TUZAVLAUJHUFLA-INIZCTEOSA-N |
|---|
| SMILES | NC(N)=NCCCC(NC(=O)c1ccccc1)C(=O)Nc1ccc(C(=O)O)cc1 |
|---|
Synonyms
| (S)-4-((5-Guanidino-2-(benzoylamino)-1-oxopentyl)amino)benzoic acid |
| EINECS 262-449-0 |
