Introduction：Basic information about CAS 7451-73-2|Cyclo(-Gly-Trp), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclo(-Gly-Trp) |
|---|
| CAS Number | 7451-73-2 | Molecular Weight | 243.26100 |
|---|
| Density | 1.334g/cm3 | Boiling Point | 675.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 362.6ºC |
|---|
Names
| Name | Cyclo(glycyl-L-tryptophyl) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.334g/cm3 |
|---|
| Boiling Point | 675.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13N3O2 |
|---|
| Molecular Weight | 243.26100 |
|---|
| Flash Point | 362.6ºC |
|---|
| Exact Mass | 243.10100 |
|---|
| PSA | 73.99000 |
|---|
| LogP | 0.98260 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | IFQZEERDQXQTLJ-NSHDSACASA-N |
|---|
| SMILES | O=C1CNC(=O)C(Cc2c[nH]c3ccccc23)N1 |
|---|
Synonyms
| c-(L-Trp-Gly) |
| 3-(indol-3-ylmethyl)-2,5-diketopiperazine |
| cyclo-L-Trp-Gly |
| Cyclo(glycyl-L-tryptophyl) |
| Cyclic glycyl-L-tryptophan |
| 2,3-(indol-3-ylmethyl)-,L |
| 2,3-(1H-indol-3-ylmethyl)-,(S) |
| cyclo(Trp-Gly) |
| (3S)-3-(3-indolylmethyl)-2,5-piperazinedione |
| cyclo-Gly-L-Trp |
| Cyclo(glycyl-L-tryptophan) |
| cyclo(Gly-Trp) |
| 3-(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| Cyclo(-Gly-Trp) |
