Introduction:Basic information about CAS 41934-47-8|7-(Diethylamino)-4-(trifluoromethyl)coumarin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-(Diethylamino)-4-(trifluoromethyl)coumarin |
|---|
| CAS Number | 41934-47-8 | Molecular Weight | 285.26200 |
|---|
| Density | 1.301g/cm3 | Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14F3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.1ºC |
|---|
Names
| Name | coumarin 481 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.301g/cm3 |
|---|
| Boiling Point | 352.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14F3NO2 |
|---|
| Molecular Weight | 285.26200 |
|---|
| Flash Point | 167.1ºC |
|---|
| Exact Mass | 285.09800 |
|---|
| PSA | 33.45000 |
|---|
| LogP | 3.65800 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | UIMOXRDVWDLOHW-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
|---|
Safety Information
Customs
| HS Code | 2932209090 |
|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-(diethylamino)-4-(trifluoromethyl)chromen-2-one |
| 2H-1-Benzopyran-2-one,7-(diethylamino)-4-(trifluoromethyl) |
| EINECS 255-593-0 |
| 7-(Diethylamino)-4-(trifluoromethyl)-2-benzopyrone |
| 7-Diethylamino-4-trifluoromethylcoumarin |
| 7-N,N-diethylamino-4-trifluoromethylcoumarin |
| 7-N,N-diethylamino-4-trifluoromethyl-1,2-benzopyrone |
| Coumarin 481 |
| Coumarin 152A |
| coumarin-481 |
| 7-(Diethylamino)-4-(trifluoromethyl)-2H-1-benzopyran-2-one |