Introduction：Basic information about CAS 5044-52-0|Vinyltriphenylphosphonium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vinyltriphenylphosphonium bromide |
|---|
| CAS Number | 5044-52-0 | Molecular Weight | 369.235 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H18BrP | Melting Point | 176-178 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | Triphenyl(vinyl)phosphonium bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 176-178 °C(lit.) |
|---|
| Molecular Formula | C20H18BrP |
|---|
| Molecular Weight | 369.235 |
|---|
| Exact Mass | 368.032928 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 1.12800 |
|---|
| InChIKey | VRAYVWUMBAJVGH-UHFFFAOYSA-M |
|---|
| SMILES | C=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| ethenyl(triphenyl)phosphanium,bromide |
| Phosphonium, ethenyltriphenyl-, bromide |
| Ethenyltriphenylphosphonium bromide |
| Triphenyl(vinyl)phosphonium bromide |
| EINECS 225-740-3 |
| Triphenylvinylphosphonium Bromide |
| MFCD00011807 |
| Schweizer’s |
| Phosphonium, ethenyltriphenyl-, bromide (1:1) |
| Vinyltriphenylphosphonium bromide |
| Schweizer's |
| Phosphonium, triphenylvinyl-, bromide |
