Introduction：Basic information about CAS 109652-10-0|5-Triphenylmethyl-1H-tetrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Triphenylmethyl-1H-tetrazole |
|---|
| CAS Number | 109652-10-0 | Molecular Weight | 312.36800 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 522.1ºC at 760 mmHg |
|---|
| Molecular Formula | C20H16N4 | Melting Point | 140-142ºC |
|---|
| MSDS | / | Flash Point | 234.9ºC |
|---|
Names
| Name | 5-trityl-2H-tetrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 522.1ºC at 760 mmHg |
|---|
| Melting Point | 140-142ºC |
|---|
| Molecular Formula | C20H16N4 |
|---|
| Molecular Weight | 312.36800 |
|---|
| Flash Point | 234.9ºC |
|---|
| Exact Mass | 312.13700 |
|---|
| PSA | 54.46000 |
|---|
| LogP | 3.58240 |
|---|
| Vapour Pressure | 5.36E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | ABPZRLQZVHPPCT-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(C(c2ccccc2)(c2ccccc2)c2nn[nH]n2)cc1 |
|---|
Synonyms
| 5-(triphenylmethyl)-2H-tetrazole |
| 5-Triphenylmethyl-tetrazol |
| N717 |
| 5-Trityl-1H-tetrazole |
| MFCD08460141 |
| AC-7606 |
| 5-Triphenylmethyl-1H-tetrazole |
