Introduction：Basic information about CAS 60706-63-0|2,3,5,6-Tetramethylbenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-Tetramethylbenzene-1-sulfonyl chloride |
|---|
| CAS Number | 60706-63-0 | Molecular Weight | 232.72700 |
|---|
| Density | 1.217g/cm3 | Boiling Point | 343.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H13ClO2S | Melting Point | 97-101 °C |
|---|
| MSDS | USA | Flash Point | 161.7ºC |
|---|
Names
| Name | 2,3,5,6-tetramethylbenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.217g/cm3 |
|---|
| Boiling Point | 343.8ºC at 760 mmHg |
|---|
| Melting Point | 97-101 °C |
|---|
| Molecular Formula | C10H13ClO2S |
|---|
| Molecular Weight | 232.72700 |
|---|
| Flash Point | 161.7ºC |
|---|
| Exact Mass | 232.03200 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.92850 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | ZCXRROBIIMQMHR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Cl)c1C |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S45-S36/37/39-S26 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,3,5,6-tetramethyl-benzenesulfonyl chloride |
| 2,3,5,6-Tetramethyl-benzolsulfonylchlorid |
| 2,3,5,6-tetramethylphenylsulfonyl chloride |
| 2,3,5,6-tetramethylbenzene-1-sulfonyl chloride |
| MFCD00014723 |
| F9995-0417 |
| 2,3,5,6-Tetramethyl-benzolsulfochlorid |
| Durolsulfonylchlorid |
