Introduction：Basic information about CAS 621-10-3|N,N'-Diphenylmalonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-Diphenylmalonamide |
|---|
| CAS Number | 621-10-3 | Molecular Weight | 254.284 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 557.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.9±25.5 °C |
|---|
Names
| Name | N,N'-diphenylpropanediamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 557.8±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14N2O2 |
|---|
| Molecular Weight | 254.284 |
|---|
| Flash Point | 229.9±25.5 °C |
|---|
| Exact Mass | 254.105530 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 2.09 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | YYAQOJILQOVUSK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)Nc1ccccc1)Nc1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Propanediamide, N,N'-diphenyl- |
| Propanediamide, N,N-diphenyl- |
| malonanilide |
| N,N'-Diphenyl-malonamid |
| N,N'-Diphenylmalonamide |
| Malonic dianilide |
| Malondianilide |
| Propanediamide,N,N'-diphenyl |
| Malonic acid diphenylamide |
| N1,N3-diphenylmalonamide |
| Malonic acid dianilide |
