Introduction：Basic information about CAS 521-85-7|corycavine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | corycavine |
|---|
| CAS Number | 521-85-7 | Molecular Weight | 367.39500 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 534.6ºC at 760mmHg |
|---|
| Molecular Formula | C21H21NO5 | Melting Point | 149° |
|---|
| MSDS | / | Flash Point | 277.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 534.6ºC at 760mmHg |
|---|
| Melting Point | 149° |
|---|
| Molecular Formula | C21H21NO5 |
|---|
| Molecular Weight | 367.39500 |
|---|
| Flash Point | 277.1ºC |
|---|
| Exact Mass | 367.14200 |
|---|
| PSA | 57.23000 |
|---|
| LogP | 3.05620 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | WOLWLEQYUFDNTA-GFCCVEGCSA-N |
|---|
| SMILES | CC1C(=O)c2cc3c(cc2CCN(C)Cc2c1ccc1c2OCO1)OCO3 |
|---|
