Introduction：Basic information about CAS 55365-63-4|gangaleoidin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | gangaleoidin |
|---|
| CAS Number | 55365-63-4 | Molecular Weight | 413.20600 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 593.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14Cl2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 312.9ºC |
|---|
Names
| Name | gangaleoidin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 593.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14Cl2O7 |
|---|
| Molecular Weight | 413.20600 |
|---|
| Flash Point | 312.9ºC |
|---|
| Exact Mass | 412.01200 |
|---|
| PSA | 91.29000 |
|---|
| LogP | 4.43590 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | RPHAAJGBADUATP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1c(OC)cc2c(c1C)Oc1c(Cl)c(O)c(Cl)c(C)c1C(=O)O2 |
|---|
Synonyms
| 2,4-dichloroquinolin-3-carbaldehyde |
| 2,4-dichloro-3-formylquinoline |
| 3-Quinolinecarboxaldehyde,2,4-dichloro |
| 2,4-Dichloroquinoline-3-carboxaldehyde |
| Gangalevidin |
