Introduction：Basic information about CAS 147217-77-4|2,4-Dibromo-1-(3-bromophenoxy)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dibromo-1-(3-bromophenoxy)benzene |
|---|
| CAS Number | 147217-77-4 | Molecular Weight | 406.895 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 372.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H7Br3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.4±25.0 °C |
|---|
Names
| Name | 2,3',4-tribromodiphenyl ether |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 372.0±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H7Br3O |
|---|
| Molecular Weight | 406.895 |
|---|
| Flash Point | 152.4±25.0 °C |
|---|
| Exact Mass | 403.804688 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 6.70 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | AURKEOPYVUYTLO-UHFFFAOYSA-N |
|---|
| SMILES | Brc1cccc(Oc2ccc(Br)cc2Br)c1 |
|---|
Synonyms
| Benzene, 2,4-dibromo-1-(3-bromophenoxy)- |
| BDE-25 |
| BDE-33 |
| 2,3,4-Tribromophenylphenyl ether |
| BDE-21 |
| 2,4-Dibromo-1-(3-bromophenoxy)benzene |
| 2,4-Dibromophenyl 3-bromophenyl ether |
| 3,4-Dibromophenyl 2-bromophenyl ether |
