Introduction：Basic information about CAS 189084-68-2|2,3,3',4,4',5,6-heptabromodiphenyl ether, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,3',4,4',5,6-heptabromodiphenyl ether |
|---|
| CAS Number | 189084-68-2 | Molecular Weight | 722.480 |
|---|
| Density | 2.6±0.1 g/cm3 | Boiling Point | 506.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H3Br7O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.1±28.6 °C |
|---|
Names
| Name | 2,3,3',4,4',5,6-heptabromodiphenyl ether |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.6±0.1 g/cm3 |
|---|
| Boiling Point | 506.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H3Br7O |
|---|
| Molecular Weight | 722.480 |
|---|
| Flash Point | 212.1±28.6 °C |
|---|
| Exact Mass | 715.446716 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 9.40 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | OUEYHQIMJGHOQN-UHFFFAOYSA-N |
|---|
| SMILES | Brc1ccc(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)cc1Br |
|---|
Synonyms
| 1,2,3,4,5-Pentabromo-6-(3,4-dibromophenoxy)benzene |
| Benzene, 1,2,3,4,5-pentabromo-6-(3,4-dibromophenoxy)- |
| 2,2-DIMETHYLTETRAHYDRO-4H-PYRAN-4-ONE |
| BDE-190 |
| 2,3,3',4,4',5,6-heptaBDE |
| BDE-191 |
| PBDE-190 |
| 2,3,3',4,4',5,6-heptabromodiphenyl ester |
| 2,3,3',4,4',5,6-heptabromodiphenylether |
