Introduction：Basic information about CAS 10024-56-3|(Z)-1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl cinnamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl cinnamate |
|---|
| CAS Number | 10024-56-3 | Molecular Weight | 287.41600 |
|---|
| Density | 1.042 g/cm3 | Boiling Point | 392.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H27O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.2ºC |
|---|
Names
| Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl (E)-3-phenylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.042 g/cm3 |
|---|
| Boiling Point | 392.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H27O2 |
|---|
| Molecular Weight | 287.41600 |
|---|
| Flash Point | 216.2ºC |
|---|
| Exact Mass | 287.20100 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.86770 |
|---|
| Vapour Pressure | 2.27E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | CKYQZYGVFMSSKH-GWKQRERASA-N |
|---|
| SMILES | CC1=CCC(C(C)(C)OC(=O)C=Cc2ccccc2)CC1 |
|---|
Synonyms
| FEMA No. 3051 |
| Terpinyl cinnamate |
| EINECS 233-023-1 |
| Terpinyl 3-phenylpropenoate |
| P-Menth-1-en-8-yl cinnamate |
| 2-Propenoic acid,3-phenyl-,1-methyl-1-(4-methyl-3-cyclohexen-1-yl)ethyl ester,(S) |
