Introduction:Basic information about CAS 27205-99-8|sodium O,O-diisopropyl dithiophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium O,O-diisopropyl dithiophosphate |
|---|
| CAS Number | 27205-99-8 | Molecular Weight | 236.26800 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 257.1ºC at 760mmHg |
|---|
| Molecular Formula | C6H14NaO2PS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 109.3ºC |
|---|
Names
| Name | sodium O,O-diisopropyl dithiophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 257.1ºC at 760mmHg |
|---|
| Molecular Formula | C6H14NaO2PS2 |
|---|
| Molecular Weight | 236.26800 |
|---|
| Flash Point | 109.3ºC |
|---|
| Exact Mass | 236.00700 |
|---|
| PSA | 60.36000 |
|---|
| LogP | 3.25840 |
|---|
| InChIKey | ZRNMDYDECQBXQW-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)OP(=S)([S-])OC(C)C.[Na+] |
|---|
Safety Information
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Phosphorodithioic acid=O,O-bis(1-methylethyl)=S-sodium salt |
| sodium diisopropyldithiophosphate |
| sodium O,O-diisopropyl phosphorodithioate |
| sodium O,O'-di-i-propyldithiophosphate |
| Natrium-O,O-diisopropyldithiophosphat |
| Sodium diisopropyl phosphorodithioate |
| Phosphorodithioic acid,O,O-bis(1-methylethyl) ester,sodium salt |
| diisopropoxide dithiophosphoric acid sodium salt |
| Dithiophosphoric acid O,O-diisopropyl ester sodium salt |
| sodium-O,O-(CH(CH3)2)2-dithiophosphate |
| phosphorodithioic acid,o,o-diisopropyl ester,sodium salt |
| sodium O,O'-diisopropyldithiophosphate |
| sodium O,O-diisopropyl dithiophosphonate |