Introduction：Basic information about CAS 105706-75-0|N- CBZ-2-piperidinemethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N- CBZ-2-piperidinemethanol |
|---|
| CAS Number | 105706-75-0 | Molecular Weight | 249.306 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 396.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.5±23.2 °C |
|---|
Names
| Name | 1-cbz-2-hydroxymethyl-piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 396.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO3 |
|---|
| Molecular Weight | 249.306 |
|---|
| Flash Point | 193.5±23.2 °C |
|---|
| Exact Mass | 249.136490 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 1.63 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.550 |
|---|
| InChIKey | UDGDHNGWPNSYCD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)N1CCCCC1CO |
|---|
Safety Information
Synonyms
| 2-Hydroxymethyl-piperidine-1-carboxylic acid benzyl ester |
| 1-Benzyloxycarbonyl-2-piperidinemethanol |
| 1-Piperidinecarboxylic acid, 2-(hydroxymethyl)-, phenylmethyl ester |
| N-benzyloxycarbonyl-2-hydroxymethylpiperidine |
| Benzyl 2-(hydroxymethyl)piperidine-1-carboxylate |
| Benzyl 2-(hydroxymethyl) piperidine-1-Carboxylate |
| 1-Cbz-2-piperidinemethanol |
| Benzyl 2-(hydroxymethyl)-1-piperidinecarboxylate |
| N-Benzyloxycarbonyl-2-piperidineMethanol |
| 1-benzyloxycarbonyl-2-hydroxymethylpiperidine |
| N- CBZ-2-piperidinemethanol |
