Introduction：Basic information about CAS 123557-86-8|DMPIO, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DMPIO |
|---|
| CAS Number | 123557-86-8 | Molecular Weight | 188.22600 |
|---|
| Density | 1.11g/cm3 | Boiling Point | 306.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H12N2O | Melting Point | 108-111ºC |
|---|
| MSDS | / | Flash Point | 139.3ºC |
|---|
Names
| Name | 2,2-dimethyl-1-oxido-4-phenylimidazol-1-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.11g/cm3 |
|---|
| Boiling Point | 306.7ºC at 760mmHg |
|---|
| Melting Point | 108-111ºC |
|---|
| Molecular Formula | C11H12N2O |
|---|
| Molecular Weight | 188.22600 |
|---|
| Flash Point | 139.3ºC |
|---|
| Exact Mass | 188.09500 |
|---|
| PSA | 41.11000 |
|---|
| LogP | 1.20090 |
|---|
| Vapour Pressure | 0.00138mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | MGZHFNJKNFACFZ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)N=C(c2ccccc2)C=[N+]1[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S37/39 |
|---|
Synonyms
| 2H-Imidazole,2,2-dimethyl-4-phenyl-,1-oxide |
| 2,2-dimethyl-4-phenyl-2-hydroimidazole 1-oxide |
| 2,2-dimethyl-4-phenyl-2H-imidazole 1-oxide |
| 2,2-dimethyl-4-phenyl-2-hydroimidazol-1-ol |
