Introduction：Basic information about CAS 225525-50-8|2-n-boc-amino-4-benzothiazole-6-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-n-boc-amino-4-benzothiazole-6-carboxylic acid |
|---|
| CAS Number | 225525-50-8 | Molecular Weight | 294.32600 |
|---|
| Density | 1.416g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H14N2O4S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-benzothiazole-6-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.416g/cm3 |
|---|
| Molecular Formula | C13H14N2O4S |
|---|
| Molecular Weight | 294.32600 |
|---|
| Exact Mass | 294.06700 |
|---|
| PSA | 116.76000 |
|---|
| LogP | 3.41450 |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | HMAATCOHUYHORT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1nc2ccc(C(=O)O)cc2s1 |
|---|
Synonyms
| 2-N-Boc-amino-4-benzothiazole-6-carboxylic acid |
| 2-N-tertbutoxycarbonylamino-benzothiazole-6-carboxylic acid |
| MFCD02179402 |
| 2-N-Boc-aminobenzothiazole-6-carboxylic acid |
| AC-6562 |
| 2-tert-butoxycarbonylaminobenzothiazole-6-carboxylic acid |
