Introduction:Basic information about CAS 81903-80-2|3,4-dibromobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-dibromobenzenesulfonyl chloride |
|---|
| CAS Number | 81903-80-2 | Molecular Weight | 334.41300 |
|---|
| Density | 2.11g/cm3 | Boiling Point | 346.9ºC at 760 mmHg |
|---|
| Molecular Formula | C6H3Br2ClO2S | Melting Point | 34ºC |
|---|
| MSDS | / | Flash Point | 163.6ºC |
|---|
Names
| Name | 3,4-dibromobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.11g/cm3 |
|---|
| Boiling Point | 346.9ºC at 760 mmHg |
|---|
| Melting Point | 34ºC |
|---|
| Molecular Formula | C6H3Br2ClO2S |
|---|
| Molecular Weight | 334.41300 |
|---|
| Flash Point | 163.6ºC |
|---|
| Exact Mass | 331.79100 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.21990 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | PBCQAUMKUSTMJD-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(Br)c(Br)c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3,4-dibromophenylsulfonyl chloride |
| 3,4-dibromophenylsulfonic acid chloride |
| 3,4-Dibrom-benzolsulfonylchlorid |
| 3,4-dibromo-benzenesulfonyl chloride |
| Benzenesulfonylchloride,3,4-dibromo |