Introduction:Basic information about CAS 93012-30-7|2,2-Biphenyldiacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Biphenyldiacetic acid |
|---|
| CAS Number | 93012-30-7 | Molecular Weight | 232.28000 |
|---|
| Density | 1.121g/cm3 | Boiling Point | 468.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H12N2 | Melting Point | 78-79ºC |
|---|
| MSDS | / | Flash Point | 231.7ºC |
|---|
Names
| Name | biphenyl-2,2'-diacetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.121g/cm3 |
|---|
| Boiling Point | 468.1ºC at 760mmHg |
|---|
| Melting Point | 78-79ºC |
|---|
| Molecular Formula | C16H12N2 |
|---|
| Molecular Weight | 232.28000 |
|---|
| Flash Point | 231.7ºC |
|---|
| Exact Mass | 232.10000 |
|---|
| PSA | 47.58000 |
|---|
| LogP | 3.48576 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | IXBKIGKDLZRRAL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccccc1-c1ccccc1CC(=O)O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2917399090 |
|---|
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2,2'-biphenyldiessigsaeure |
| MFCD00060295 |
| Biphenyl-2,2'-diyldi-essigsaeure |
| Phosphorothioic acid,O,O-dimethyl ester,O-ester with 3-chloro-4-hydroxybenzonitrile |
| biphenyl-2,2'-diyldi-acetic acid |