Introduction:Basic information about CAS 884497-65-8|chembrdg-bb 6966505, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | chembrdg-bb 6966505 |
|---|
| CAS Number | 884497-65-8 | Molecular Weight | 277.29600 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 516.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 266.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 516.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO4S |
|---|
| Molecular Weight | 277.29600 |
|---|
| Flash Point | 266.1ºC |
|---|
| Exact Mass | 277.04100 |
|---|
| PSA | 101.79000 |
|---|
| LogP | 2.23260 |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | VDHAXZSRBIEISQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2nc(SCC(=O)O)c(C=O)cc2c1 |
|---|