Introduction：Basic information about CAS 6655-77-2|Benzenesulfonic acid,3-nitro-, hydrazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,3-nitro-, hydrazide |
|---|
| CAS Number | 6655-77-2 | Molecular Weight | 217.20200 |
|---|
| Density | 1.562g/cm3 | Boiling Point | 421.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H7N3O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.9ºC |
|---|
Names
| Name | 2-nitrobenzenesulfonyl hydrazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.562g/cm3 |
|---|
| Boiling Point | 421.8ºC at 760 mmHg |
|---|
| Molecular Formula | C6H7N3O4S |
|---|
| Molecular Weight | 217.20200 |
|---|
| Flash Point | 208.9ºC |
|---|
| Exact Mass | 217.01600 |
|---|
| PSA | 126.39000 |
|---|
| LogP | 2.44200 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | IHLRXXTYALIWND-UHFFFAOYSA-N |
|---|
| SMILES | NNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 3-nitro-benzenesulfonic acid hydrazide |
| m-Nitrophenylsulfonhydrazid |
| 3-nitrobenzenesulfonhydrazide |
| m-Nitrobenzolsulfonylhydrazid |
| 3-Nitro-benzolsulfonsaeure-hydrazid |
| 3-nitrophenylsulfonohydrazide |
