Introduction：Basic information about CAS 74098-43-4|tris(trimethylsiloxy)silanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris(trimethylsiloxy)silanol |
|---|
| CAS Number | 74098-43-4 | Molecular Weight | 354.69500 |
|---|
| Density | 0.913 | Boiling Point | 85ºC |
|---|
| Molecular Formula | C11H30O5Si4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 99.4ºC |
|---|
Names
| Name | tris(trimethylsiloxy)silanol |
|---|
Chemical & Physical Properties
| Density | 0.913 |
|---|
| Boiling Point | 85ºC |
|---|
| Molecular Formula | C11H30O5Si4 |
|---|
| Molecular Weight | 354.69500 |
|---|
| Flash Point | 99.4ºC |
|---|
| Exact Mass | 354.11700 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 3.53960 |
|---|
| Index of Refraction | 1.419 |
|---|
| InChIKey | LWWKLKSYKPNLMG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
|---|
Safety Information
| Risk Phrases | R10;R36/38 |
|---|
| Safety Phrases | S16-S26-S36 |
|---|
