Introduction：Basic information about CAS 126-58-9|Dipentaerythritol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dipentaerythritol |
|---|
| CAS Number | 126-58-9 | Molecular Weight | 254.277 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 542.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H22O7 | Melting Point | 215-218 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 282.1±28.7 °C |
|---|
Names
| Name | Dipentaerythritol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 542.8±45.0 °C at 760 mmHg |
|---|
| Melting Point | 215-218 °C(lit.) |
|---|
| Molecular Formula | C10H22O7 |
|---|
| Molecular Weight | 254.277 |
|---|
| Flash Point | 282.1±28.7 °C |
|---|
| Exact Mass | 254.136551 |
|---|
| PSA | 130.61000 |
|---|
| LogP | -2.06 |
|---|
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | TXBCBTDQIULDIA-UHFFFAOYSA-N |
|---|
| SMILES | OCC(CO)(CO)COCC(CO)(CO)CO |
|---|
| Water Solubility | 0.29 g/100 mL (20 ºC) |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 1 |
|---|
| HS Code | 29094919 |
|---|
Customs
| HS Code | 2909499000 |
|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| D-PE |
| Dipentarit SP |
| 2,2'-[Oxybis(methylene)]bis[2-(hydroxymethyl)propane-1,3-diol] |
| Dipentek |
| 2,2'-(Oxybis(methylene))bis(2-(hydroxymethyl)propane-1,3-diol) |
| D-PE300 |
| Bis[2,2,2-tris(hydroxymethyl)ethyl] Ether |
| Dipentalide |
| Dipentaerythrit |
| Dipentaerythritol (8CI) |
| Dipentaerythitol |
| 2,2'-[Oxybis(methylene)]bis[2-(hydroxymethyl)-1,3-propanediol] |
| Dipentaerythritol |
| dipentaerythrite |
| MFCD00004691 |
| Bis-pentaerythritol |
| Hercules Tech Di-PE |
| EINECS 204-794-1 |
| dipentaerithritol |
| 2,2'-(oxydimethanediyl)bis[2-(hydroxymethyl)propane-1,3-diol] |
| Di-Pentarit 300 |
| 1,3-Propanediol, 2,2'-[oxybis(methylene)]bis[2-(hydroxymethyl)- |
