Introduction：Basic information about CAS 10448-96-1|Almestrone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Almestrone |
|---|
| CAS Number | 10448-96-1 | Molecular Weight | 284.393 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 448.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.2±21.3 °C |
|---|
Names
| Name | Almestrone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 448.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24O2 |
|---|
| Molecular Weight | 284.393 |
|---|
| Flash Point | 191.2±21.3 °C |
|---|
| Exact Mass | 284.177643 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.18 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | JUAJXSMWFOFDFC-MNHDCVOLSA-N |
|---|
| SMILES | CC1Cc2cc(O)ccc2C2CCC3(C)C(=O)CCC3C12 |
|---|
Synonyms
| Estra-1,3,5(10)-trien-17-one, 3-hydroxy-7-methyl-, (7α)- |
| 7a-Methylestrone |
| 7α-Methylestrone |
| 3-Hydroxy-7a-methylestra-1,3,5(10)-trien-17-one |
| Almestrone [INN] |
| (7α)-3-Hydroxy-7-methylestra-1,3,5(10)-trien-17-one |
| (7α)-3-Hydroxy-7-methylestra-1(10),2,4-trien-17-one |
| 3-Hydroxy-7α-methylestra-1,3,5(10)-trien-17-one |
| (7a)-3-Hydroxy-7-methylestra-1(10),2,4-trien-17-one |
| estra-1(10),2,4-trien-17-one, 3-hydroxy-7-methyl-, (7α)- |
