Introduction：Basic information about CAS 4182-80-3|N,N,N',N'-Tetrakis[4-(dibutylamino)phenyl]benzene-1,4-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N,N',N'-Tetrakis[4-(dibutylamino)phenyl]benzene-1,4-diamine |
|---|
| CAS Number | 4182-80-3 | Molecular Weight | 921.43400 |
|---|
| Density | 1.023 g/cm3 | Boiling Point | 916.7ºC at 760 mmHg |
|---|
| Molecular Formula | C62H92N6 | Melting Point | 92-94ºC |
|---|
| MSDS | / | Flash Point | 340.7ºC |
|---|
Names
| Name | 1-N,1-N-dibutyl-4-N-[4-[4-(dibutylamino)-N-[4-(dibutylamino)phenyl]anilino]phenyl]-4-N-[4-(dibutylamino)phenyl]benzene-1,4-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.023 g/cm3 |
|---|
| Boiling Point | 916.7ºC at 760 mmHg |
|---|
| Melting Point | 92-94ºC |
|---|
| Molecular Formula | C62H92N6 |
|---|
| Molecular Weight | 921.43400 |
|---|
| Flash Point | 340.7ºC |
|---|
| Exact Mass | 920.73800 |
|---|
| PSA | 19.44000 |
|---|
| LogP | 18.25260 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | GVNSFLFOZIYBPH-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCCC)c1ccc(N(c2ccc(N(CCCC)CCCC)cc2)c2ccc(N(c3ccc(N(CCCC)CCCC)cc3)c3ccc(N(CCCC)CCCC)cc3)cc2)cc1 |
|---|
Safety Information
Synonyms
| tetrakis-[N,N,N',N'-(p-(N",N"-di-(n-butyl)amino)phenyl)]phenylenediamine |
| N,N,N',N'-Tetrakis(4-(dibutylamino)phenyl)-1,4-benzenediamine |
| N,N,N',N'-tetrakis(p-dibutylaminophenyl)-p-phenylene diamine |
| N1,N1'-(1,4-Phenylene)bis(N4,N4-dibutyl-N1-(4-(dibutylamino)phenyl)benzene-1,4-diamine) |
| N,N,N',N'-tetrakis{p-di(n-butyl)aminophenyl}-p-phenylene diamine |
| N,N,N',N'-Tetrakis(4-(dibutylamino)phenyl)benzene-1,4-diamine |
