Introduction：Basic information about CAS 2432-87-3|Dioctyl sebacate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dioctyl sebacate |
|---|
| CAS Number | 2432-87-3 | Molecular Weight | 426.673 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 442.0±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H50O4 | Melting Point | -55ºC |
|---|
| MSDS | USA | Flash Point | 198.4±18.2 °C |
|---|
Names
| Name | dioctyl decanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 442.0±13.0 °C at 760 mmHg |
|---|
| Melting Point | -55ºC |
|---|
| Molecular Formula | C26H50O4 |
|---|
| Molecular Weight | 426.673 |
|---|
| Flash Point | 198.4±18.2 °C |
|---|
| Exact Mass | 426.370911 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 10.23 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.455 |
|---|
| InChIKey | MIMDHDXOBDPUQW-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCOC(=O)CCCCCCCCC(=O)OCCCCCCCC |
|---|
| Freezing Point | -48℃ |
|---|
Safety Information
Customs
| HS Code | 2917131000 |
|---|
| Summary | 2917131000 esters of adipic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| di-octyl sebacate |
| Decanedioic acid, dioctyl ester |
| EINECS 219-411-3 |
| Dioctyl sebacate |
| Decandisaeure-dioctylester |
| Decanedioic acid dioctyl ester |
| dioctyl decanedioate |
| Succinic acid, dioctyl ester |
| Dioctyl succinate |
| Sebacic acid,dioctyl ester |
| Dioctyl butanedioate |
| Sebacic Acid Di-n-octyl Ester |
| Di-n-octyl Sebacate |
| MFCD00059269 |
| Octyl sebacate |
| Sebacinsaeure-di-n-octylester |
| Sebacic acid, dioctyl ester |
| Butanedioic acid, dioctyl ester |
| Witamol 500 |
| Decanedioic acid,dioctyl ester |
