Introduction：Basic information about CAS 5634-37-7|Ethanol,2,2,2-trichloro-, 1-(2,2,2-trichloroethyl)carbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanol,2,2,2-trichloro-, 1-(2,2,2-trichloroethyl)carbonate |
|---|
| CAS Number | 5634-37-7 | Molecular Weight | 324.80100 |
|---|
| Density | 1.715g/cm3 | Boiling Point | 331.4ºC at 760mmHg |
|---|
| Molecular Formula | C5H4Cl6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 135.9ºC |
|---|
Names
| Name | bis(2,2,2-trichloroethyl) carbonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.715g/cm3 |
|---|
| Boiling Point | 331.4ºC at 760mmHg |
|---|
| Molecular Formula | C5H4Cl6O3 |
|---|
| Molecular Weight | 324.80100 |
|---|
| Flash Point | 135.9ºC |
|---|
| Exact Mass | 321.82900 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.88000 |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | IEPBPSSCIZTJIF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC(Cl)(Cl)Cl)OCC(Cl)(Cl)Cl |
|---|
Synonyms
| 2,2,2-trichloroethyl carbonate |
| Clorethate |
| Bis-<2,2,2-trichlor-ethyl>-carbonat |
| Trichloroethyl carbonate |
| bis-tricloroetilcarbonato |
| di-(2,2,2-trichloroethyl)-carbonate |
| Cloretat |
| Cloretate |
| Cloretatum [INN-Latin] |
| Chlorethate |
| Bis(trichloroethyl)carbonat |
| Cloretato [INN-Spanish] |
