Introduction：Basic information about CAS 37529-08-1|Mexoprofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mexoprofen |
|---|
| CAS Number | 37529-08-1 | Molecular Weight | 246.34500 |
|---|
| Density | 1.046g/cm3 | Boiling Point | 383.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H22O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280ºC |
|---|
Names
| Name | 2-[4-[(1R,2R)-2-methylcyclohexyl]phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.046g/cm3 |
|---|
| Boiling Point | 383.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H22O2 |
|---|
| Molecular Weight | 246.34500 |
|---|
| Flash Point | 280ºC |
|---|
| Exact Mass | 246.16200 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.16840 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | DXKIKFNSKJTQBC-KKXIITGPSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc(C2CCCCC2C)cc1 |
|---|
Synonyms
| Mexoprofene |
| Mexoprofen |
| Mexoprofenum |
| Mexoprofeno |
| UNII-3I63VC13V0 |
| 4-(trans-2-Methylcyclohexyl)hydratropsaeure |
