Introduction：Basic information about CAS 50650-76-5|piroctone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | piroctone |
|---|
| CAS Number | 50650-76-5 | Molecular Weight | 237.33800 |
|---|
| Density | 1.029 | Boiling Point | 344.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H23NO2 | Melting Point | 108ºC |
|---|
| MSDS | / | Flash Point | 161.9ºC |
|---|
Names
| Name | piroctone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.029 |
|---|
| Boiling Point | 344.1ºC at 760 mmHg |
|---|
| Melting Point | 108ºC |
|---|
| Molecular Formula | C14H23NO2 |
|---|
| Molecular Weight | 237.33800 |
|---|
| Flash Point | 161.9ºC |
|---|
| Exact Mass | 237.17300 |
|---|
| PSA | 42.23000 |
|---|
| LogP | 3.00880 |
|---|
| Index of Refraction | 1.512 |
|---|
| InChIKey | OIQJEQLSYJSNDS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Piroctonum |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2-one |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1H)-pyridone |
| 6-(2,4,4-trimethylpentyl)-1-hydroxy-4-methyl-2(1H)-pyridone |
| Piroctone (USAN/INN) |
| Piroctona |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1 H)-pyridinone |
| 1-hydroxy-4-methyl-6-(2,4,4-trimethyl-pentyl)-2-pyridone |
| Piroctone |
| Piroctonum [INN-Latin] |
