Introduction：Basic information about CAS 20326-13-0|Tolpiprazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tolpiprazole |
|---|
| CAS Number | 20326-13-0 | Molecular Weight | 284.39900 |
|---|
| Density | 1.114g/cm3 | Boiling Point | 483ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.9ºC |
|---|
Names
| Name | 1-(3-methylphenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.114g/cm3 |
|---|
| Boiling Point | 483ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N4 |
|---|
| Molecular Weight | 284.39900 |
|---|
| Flash Point | 245.9ºC |
|---|
| Exact Mass | 284.20000 |
|---|
| PSA | 35.16000 |
|---|
| LogP | 2.39410 |
|---|
| Vapour Pressure | 1.74E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | IYBFBADVQPQHLQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(N2CCN(CCc3cc(C)[nH]n3)CC2)c1 |
|---|
Synonyms
| H 4170 |
| 1-[2-(5-methyl-1(2)H-pyrazol-3-yl)-ethyl]-4-m-tolyl-piperazine |
| Tolpiprazole [INN:BAN] |
| Tolpiprazole |
| UNII-8XP74P4HO3 |
| 1-(2-(5-Methylpyrazol-3-yl)ethyl)-4-m-tolylpiperazine |
| 3-<2-(N'-m-Tolylpiperazino)-ethyl>-5-methylpyrazol |
