Introduction：Basic information about CAS 52231-20-6|(6R,7R)-3-methyl-8-oxo-7-[[2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]acety, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (6R,7R)-3-methyl-8-oxo-7-[[2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
| CAS Number | 52231-20-6 | Molecular Weight | 414.47800 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 823.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H22N4O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 451.9ºC |
|---|
Names
| Name | (6R,7R)-3-methyl-8-oxo-7-[[2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 823.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H22N4O4S |
|---|
| Molecular Weight | 414.47800 |
|---|
| Flash Point | 451.9ºC |
|---|
| Exact Mass | 414.13600 |
|---|
| PSA | 136.40000 |
|---|
| LogP | 0.82070 |
|---|
| Index of Refraction | 1.745 |
|---|
| InChIKey | QFTZCQVZVRVDTD-DNVCBOLYSA-N |
|---|
| SMILES | CC1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3ccc(C4=NCCCN4)cc3)C2SC1 |
|---|
Synonyms
| (6r,7r)-3-methyl-8-oxo-7-(2-(p-(1,4,5,6-tetrahydro-2-pyrimidinyl)phenyl)acetamido)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Cefrotilo |
| Cefrotilum |
| Cefrotil |
| Cefrotilum [INN-Latin] |
| Cefrotilo [INN-Spanish] |
