Introduction：Basic information about CAS 7008-18-6|Iminophenimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Iminophenimide |
|---|
| CAS Number | 7008-18-6 | Molecular Weight | 218.25200 |
|---|
| Density | 1.138g/cm3 | Boiling Point | 413.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.4ºC |
|---|
Names
| Name | 3-ethyl-3-phenylpiperazine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.138g/cm3 |
|---|
| Boiling Point | 413.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14N2O2 |
|---|
| Molecular Weight | 218.25200 |
|---|
| Flash Point | 174.4ºC |
|---|
| Exact Mass | 218.10600 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 1.19550 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | ANPJDCDLXKNSPS-UHFFFAOYSA-N |
|---|
| SMILES | CCC1(c2ccccc2)NCC(=O)NC1=O |
|---|
Synonyms
| Iminophenimidum |
| UNII-H0X939RX9W |
| iminophenimide |
| Iminofenimida |
| 3.5-Dioxo-2-aethyl-2-phenyl-piperazin |
| 3-ethyl-3-phenyl-piperazine-2,6-dione |
| 3-Aethyl-3-phenyl-piperazin-2,6-dion |
| Iminophenimide [INN] |
