Introduction：Basic information about CAS 69907-17-1|Indopanolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Indopanolol |
|---|
| CAS Number | 69907-17-1 | Molecular Weight | 374.86100 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 598.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 316ºC |
|---|
Names
| Name | 1-[(3-chloro-2-methyl-3H-indol-4-yl)oxy]-3-(2-phenoxyethylamino)propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 598.9ºC at 760 mmHg |
|---|
| Molecular Formula | C20H23ClN2O3 |
|---|
| Molecular Weight | 374.86100 |
|---|
| Flash Point | 316ºC |
|---|
| Exact Mass | 374.14000 |
|---|
| PSA | 66.51000 |
|---|
| LogP | 3.92890 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | KTODVGFADXOWDU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1[nH]c2cccc(OCC(O)CNCCOc3ccccc3)c2c1Cl |
|---|
Synonyms
| 1-(3-chloro-2-methylindol-4-yloxy)-3-(2-phenoxyethylamino)-2-propanol |
| Indopanolol [INN] |
| Indopanololum |
| (-)-1-((3-Chlor-2-methyl-4-indolyl)oxy)-3-((2-phenoxyethyl)amino)-2-propanol |
| UNII-2JQ3661CAD |
