Introduction：Basic information about CAS 115574-30-6|Irtemazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Irtemazole |
|---|
| CAS Number | 115574-30-6 | Molecular Weight | 288.34600 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 554ºC at 760mmHg |
|---|
| Molecular Formula | C18H16N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 288.9ºC |
|---|
Names
| Name | 6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1H-benzimidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 554ºC at 760mmHg |
|---|
| Molecular Formula | C18H16N4 |
|---|
| Molecular Weight | 288.34600 |
|---|
| Flash Point | 288.9ºC |
|---|
| Exact Mass | 288.13700 |
|---|
| PSA | 46.50000 |
|---|
| LogP | 3.70550 |
|---|
| Vapour Pressure | 9.46E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.684 |
|---|
| InChIKey | DCGOMTSIZLGUOK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2ccc(C(c3ccccc3)n3ccnc3)cc2[nH]1 |
|---|
Synonyms
| Irtemazole (USAN/INN) |
| 5-(imidazol-1-yl-phenyl-methyl)-2-methyl-3H-benzoimidazole |
| Irtemazole |
| ( inverted exclamation markA)-5-(a-imidazol-1-ylbenzyl)-2-methylbenzimidazole |
| Irtemazol |
| Irtemazolum |
