Introduction：Basic information about CAS 42110-58-7|2-(4-methylpiperidin-1-yl)ethyl 6-ethyl-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-methylpiperidin-1-yl)ethyl 6-ethyl-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f]quinoline-8-carboxylate |
|---|
| CAS Number | 42110-58-7 | Molecular Weight | 429.53200 |
|---|
| Density | 1.276g/cm3 | Boiling Point | 598.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H27N3O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 316ºC |
|---|
Names
| Name | 2-(4-methylpiperidin-1-yl)ethyl 6-ethyl-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f]quinoline-8-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.276g/cm3 |
|---|
| Boiling Point | 598.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H27N3O4S |
|---|
| Molecular Weight | 429.53200 |
|---|
| Flash Point | 316ºC |
|---|
| Exact Mass | 429.17200 |
|---|
| PSA | 101.78000 |
|---|
| LogP | 2.76140 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | IXQKKLAOJKWQCM-UHFFFAOYSA-N |
|---|
| SMILES | CCn1cc(C(=O)OCCN2CCC(C)CC2)c(=O)c2c3sc(=O)n(C)c3ccc21 |
|---|
Synonyms
| 2-(4-Methylpiperidino)ethyl 6-ethyl-2,3,6,9-tetrahydro-3-methyl-2,9-dioxothiazolo(5,4-f)quinoline-8-carboxylate |
| UNII-00V69U1QC7 |
| Metioxato |
| Metioxatum |
| Metioxate |
| Metioxate [INN] |
| 6-ethyl-3-methyl-2,9-dioxo-2,3,6,9-tetrahydro-thiazolo[5,4-f]quinoline-8-carboxylic acid 2-(4-methyl-piperidin-1-yl)-ethyl ester |
