Introduction：Basic information about CAS 52157-83-2|Mindoperone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Mindoperone |
|---|
| CAS Number | 52157-83-2 | Molecular Weight | 408.50800 |
|---|
| Density | 1.171g/cm3 | Boiling Point | 601.4ºC at 760mmHg |
|---|
| Molecular Formula | C25H29FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.5ºC |
|---|
Names
| Name | 1-(4-fluorophenyl)-4-[4-(6-methoxy-2-methyl-1H-indol-3-yl)piperidin-1-yl]butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.171g/cm3 |
|---|
| Boiling Point | 601.4ºC at 760mmHg |
|---|
| Molecular Formula | C25H29FN2O2 |
|---|
| Molecular Weight | 408.50800 |
|---|
| Flash Point | 317.5ºC |
|---|
| Exact Mass | 408.22100 |
|---|
| PSA | 45.33000 |
|---|
| LogP | 5.40440 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | URAQFJBGJKTOGQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(C3CCN(CCCC(=O)c4ccc(F)cc4)CC3)c(C)[nH]c2c1 |
|---|
Synonyms
| Mindoperone |
| Mindoperonum |
| Mindoperon |
| Mindoperona |
| UNII-556OP2G5M2 |
| Mindoperone [INN] |
