Introduction:Basic information about CAS 42461-79-0|4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(methylsulfonylmethyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(methylsulfonylmethyl)phenol |
|---|
| CAS Number | 42461-79-0 | Molecular Weight | 301.40200 |
|---|
| Density | 1.216g/cm3 | Boiling Point | 540.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H23NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280.6ºC |
|---|
Names
| Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(methylsulfonylmethyl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.216g/cm3 |
|---|
| Boiling Point | 540.4ºC at 760mmHg |
|---|
| Molecular Formula | C14H23NO4S |
|---|
| Molecular Weight | 301.40200 |
|---|
| Flash Point | 280.6ºC |
|---|
| Exact Mass | 301.13500 |
|---|
| PSA | 95.01000 |
|---|
| LogP | 2.83000 |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | RTLJQOLVPIGICL-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(CS(C)(=O)=O)c1 |
|---|
Synonyms
| 2-(tert-Butylamino)-1-(4-hydroxy-3-(methylsulfonylmethyl)phenyl)ethanol |
| Sulfonterol |
| Sulfonterol [INN] |
| UNII-Z540ZT2MI6 |
| Sulfonterolum |
| Sulfonterolum [INN-Latin] |
| (+-)-4-Hydroxy-3-methylsulfonylmethyl-1-<2-(tert.-butylamino)-1-hydroxy-aethyl>-benzol |