Introduction：Basic information about CAS 16498-21-8|Oxaflumazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Oxaflumazine |
|---|
| CAS Number | 16498-21-8 | Molecular Weight | 507.61100 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 605.5ºC at 760mmHg |
|---|
| Molecular Formula | C26H32F3N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320ºC |
|---|
Names
| Name | 10-[3-[4-[2-(1,3-dioxan-2-yl)ethyl]piperazin-1-yl]propyl]-2-(trifluoromethyl)phenothiazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 605.5ºC at 760mmHg |
|---|
| Molecular Formula | C26H32F3N3O2S |
|---|
| Molecular Weight | 507.61100 |
|---|
| Flash Point | 320ºC |
|---|
| Exact Mass | 507.21700 |
|---|
| PSA | 53.48000 |
|---|
| LogP | 5.40970 |
|---|
| Vapour Pressure | 1.31E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | GXCXYCOOYDMQOK-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)c1ccc2c(c1)N(CCCN1CCN(CCC3OCCCO3)CC1)c1ccccc1S2 |
|---|
Synonyms
| Ossaflumazina [DCIT] |
| Oxaflumazine [INN:DCF] |
| Ossaflumazina |
| Oxaflumazina |
| 10-{3-[4-(2-[1,3]dioxan-2-yl-ethyl)-piperazin-1-yl]-propyl}-2-trifluoromethyl-10H-phenothiazine |
| Oxaflumazine |
| Oxaflumazinum |
