Introduction：Basic information about CAS 85702-89-2|Tazeprofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tazeprofen |
|---|
| CAS Number | 85702-89-2 | Molecular Weight | 283.34500 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 479ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 479ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NO2S |
|---|
| Molecular Weight | 283.34500 |
|---|
| Flash Point | 243.5ºC |
|---|
| Exact Mass | 283.06700 |
|---|
| PSA | 78.43000 |
|---|
| LogP | 4.15140 |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | DPRKTNKWAXPYNW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc2nc(-c3ccccc3)sc2c1 |
|---|
