Introduction：Basic information about CAS 28168-10-7|Tetriprofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetriprofen |
|---|
| CAS Number | 28168-10-7 | Molecular Weight | 230.30200 |
|---|
| Density | 1.114g/cm3 | Boiling Point | 374.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.4ºC |
|---|
Names
| Name | 2-[4-(cyclohexen-1-yl)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.114g/cm3 |
|---|
| Boiling Point | 374.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O2 |
|---|
| Molecular Weight | 230.30200 |
|---|
| Flash Point | 271.4ºC |
|---|
| Exact Mass | 230.13100 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.83210 |
|---|
| Vapour Pressure | 2.83E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | CVBPQTZKZQWEFX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc(C2=CCCCC2)cc1 |
|---|
Synonyms
| Tetriprofen [INN] |
| p-1-cyclohexen-1-ylhydratropic acid |
| 2-[4-(1-cyclohexen-1-yl)-phenyl]propionic acid |
| 47-210 [as sodium] |
| 4-Cyclohexenylhydratropasaeure |
| UNII-8JG5454O0D |
| tetriprofen |
