Introduction：Basic information about CAS 5966-41-6|3,3-diphenyl-N,N-di(propan-2-yl)propan-1-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3-diphenyl-N,N-di(propan-2-yl)propan-1-amine |
|---|
| CAS Number | 5966-41-6 | Molecular Weight | 295.46200 |
|---|
| Density | 0.954g/cm3 | Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C21H29N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.8ºC |
|---|
Names
| Name | 3,3-diphenyl-N,N-di(propan-2-yl)propan-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.954g/cm3 |
|---|
| Boiling Point | 391.7ºC at 760 mmHg |
|---|
| Molecular Formula | C21H29N |
|---|
| Molecular Weight | 295.46200 |
|---|
| Flash Point | 170.8ºC |
|---|
| Exact Mass | 295.23000 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 5.32740 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | YBJKOPHEJOMRMN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N(CCC(c1ccccc1)c1ccccc1)C(C)C |
|---|
Synonyms
| Diisopropyl-(3,3-diphenylpropyl)-amin |
| Megabyl |
| R 253 |
| Dispromine |
| Diisoprominum |
| disopromine |
| Diisopromin |
| N,N-diisopropyl-3,3-diphenylpropan-1-amine |
| N-(3,3-diphenylpropyl)diisopropylamine |
| Disoprominum |
| N,N-diisopropyl-3,3-diphenylpropylamine |
| Diisopromina |
| Do-Bil |
| DIISOPROMINE |
