Introduction:Basic information about CAS 1050-79-9|1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one |
|---|
| CAS Number | 1050-79-9 | Molecular Weight | 355.44600 |
|---|
| Density | 1.155g/cm3 | Boiling Point | 517.7ºC at 760mmHg |
|---|
| Molecular Formula | C22H26FNO2 | Melting Point | 118-119ºC |
|---|
| MSDS | / | Flash Point | 266.9ºC |
|---|
Names
| Name | 1-(4-fluorophenyl)-4-[4-hydroxy-4-(4-methylphenyl)piperidin-1-yl]butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.155g/cm3 |
|---|
| Boiling Point | 517.7ºC at 760mmHg |
|---|
| Melting Point | 118-119ºC |
|---|
| Molecular Formula | C22H26FNO2 |
|---|
| Molecular Weight | 355.44600 |
|---|
| Flash Point | 266.9ºC |
|---|
| Exact Mass | 355.19500 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 4.01850 |
|---|
| Vapour Pressure | 1.52E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | AGAHNABIDCTLHW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(4-fluoro-phenyl)-4-(4-hydroxy-4-p-tolyl-piperidino)-butan-1-one |
| Moperone [INN] |
| fluoro-4'(hydroxy-4 p-tolyl-4 piperidino)-4 butyrophenone |
| Methylperidol |
| 1-(4-fluoro-phenyl)-4-(4-hydroxy-4-p-tolyl-piperidin-1-yl)-butan-1-one |
| Luvatren |
| Moperone HCl |
| Meperon |
| Moperone |
| Luvatrena |