Introduction:Basic information about CAS 2393-97-7|1-chloro-4-[(4-chlorophenyl)sulfanylmethylsulfanyl]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-chloro-4-[(4-chlorophenyl)sulfanylmethylsulfanyl]benzene |
|---|
| CAS Number | 2393-97-7 | Molecular Weight | 301.25500 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 193-195ºC 2mm |
|---|
| Molecular Formula | C13H10Cl2S2 | Melting Point | 45-48ºC |
|---|
| MSDS | / | Flash Point | 192.5ºC |
|---|
Names
| Name | 1-chloro-4-[(4-chlorophenyl)sulfanylmethylsulfanyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 193-195ºC 2mm |
|---|
| Melting Point | 45-48ºC |
|---|
| Molecular Formula | C13H10Cl2S2 |
|---|
| Molecular Weight | 301.25500 |
|---|
| Flash Point | 192.5ºC |
|---|
| Exact Mass | 299.96000 |
|---|
| PSA | 50.60000 |
|---|
| LogP | 5.83530 |
|---|
| Vapour Pressure | 6.64E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | NTZBITFHYUVXFR-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc(SCSc2ccc(Cl)cc2)cc1 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Formaldehyd-[bis-(4-chlor-phenyl)-dithioacetal] |
| bis(p-chlorophenylthio)methane |
| MFCD00041407 |
| 1-Chloro-4-(([(4-chlorophenyl)sulfanyl]methyl)sulfanyl)benzene |
| formaldehyde-[bis-(4-chloro-phenyl)-dithioacetal] |
| Bis-<4-chlor-phenylmercapto>-methan |
| di(4-chlorophenylthio)methane |
| Bis(4-chlorophenylthio)methane |
| bis(4-chlorophenylmercapto)methane |