Introduction：Basic information about CAS 727-49-1|Heptafluoronaphthalen-2-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Heptafluoronaphthalen-2-ol |
|---|
| CAS Number | 727-49-1 | Molecular Weight | 270.10300 |
|---|
| Density | 1.783g/cm3 | Boiling Point | 275.4ºC at 760 mmHg |
|---|
| Molecular Formula | C10HF7O | Melting Point | 120-124ºC |
|---|
| MSDS | / | Flash Point | 120.4ºC |
|---|
Names
| Name | 1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.783g/cm3 |
|---|
| Boiling Point | 275.4ºC at 760 mmHg |
|---|
| Melting Point | 120-124ºC |
|---|
| Molecular Formula | C10HF7O |
|---|
| Molecular Weight | 270.10300 |
|---|
| Flash Point | 120.4ºC |
|---|
| Exact Mass | 269.99200 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.51910 |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | RWEQEWKAJFTONV-UHFFFAOYSA-N |
|---|
| SMILES | Oc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| 1,3,4,5,6,7,8-heptafluoro-2-naphthol |
| heptafluoronaphth-2-ol |
| Heptafluoro-2-naphthol |
| PC4492 |
| heptafluoronaphthalen-2-ol |
| 2-heptafluoronaphthol |
| heptafluoro-2-naphtol |
| 2-heptaflouronaphthol |
