Introduction：Basic information about CAS 56462-76-1|Ethyl2-amino-2-[2-(4-chlorophenyl)hydrazono]-acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl2-amino-2-[2-(4-chlorophenyl)hydrazono]-acetate |
|---|
| CAS Number | 56462-76-1 | Molecular Weight | 241.67400 |
|---|
| Density | 1.317g/cm3 | Boiling Point | 356.835ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.608ºC |
|---|
Names
| Name | ethyl 2-amino-2-[(4-chlorophenyl)hydrazinylidene]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.317g/cm3 |
|---|
| Boiling Point | 356.835ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12ClN3O2 |
|---|
| Molecular Weight | 241.67400 |
|---|
| Flash Point | 169.608ºC |
|---|
| Exact Mass | 241.06200 |
|---|
| PSA | 76.71000 |
|---|
| LogP | 2.36050 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | SDHHJNXBVCVUHS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(N)=NNc1ccc(Cl)cc1 |
|---|
Synonyms
| Amino-(4-chlor-phenylhydrazono)-essigsaeure-aethylester |
| Ethyl 2-amino-2-[2-(4-chlorophenyl)hydrazono] |
| amino-(4-chloro-phenylhydrazono)-acetic acid ethyl ester |
| 2-amino-2-[(4-chlorophenyl)hydrazinylidene]acetic acid ethyl ester |
| Imino-(4-chlor-phenylhydrazino)-essigsaeure-aethylester |
| Oxalsaeure-aethylester-[amid-(4-chlor-phenylhydrazon)] |
| Ethyl2-amino-2-[2-(4-chlorophenyl)hydrazono]-acetate |
| ethyl 2-azanyl-2-[(4-chlorophenyl)hydrazinylidene]ethanoate |
