Introduction:Basic information about CAS 948293-69-4|5,7-Dichloro-2-methylquinoline-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,7-Dichloro-2-methylquinoline-3-carboxylic acid |
|---|
| CAS Number | 948293-69-4 | Molecular Weight | 256.08500 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 405ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7Cl2NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.8ºC |
|---|
Names
| Name | 5,7-Dichloro-2-methylquinoline-3-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 405ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7Cl2NO2 |
|---|
| Molecular Weight | 256.08500 |
|---|
| Flash Point | 198.8ºC |
|---|
| Exact Mass | 254.98500 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.54820 |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | WBCUCYBGTNOGBW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2cc(Cl)cc(Cl)c2cc1C(=O)O |
|---|