Introduction:Basic information about CAS 948294-04-0|5-Bromo-2-chloro-6-methoxyquinoline-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-2-chloro-6-methoxyquinoline-3-carbonitrile |
|---|
| CAS Number | 948294-04-0 | Molecular Weight | 297.53500 |
|---|
| Density | 1.71g/cm3 | Boiling Point | 440.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6BrClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.3ºC |
|---|
Names
| Name | 5-Bromo-2-chloro-6-methoxyquinoline-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.71g/cm3 |
|---|
| Boiling Point | 440.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H6BrClN2O |
|---|
| Molecular Weight | 297.53500 |
|---|
| Flash Point | 220.3ºC |
|---|
| Exact Mass | 295.93500 |
|---|
| PSA | 45.91000 |
|---|
| LogP | 3.53098 |
|---|
| Index of Refraction | 1.68 |
|---|
| InChIKey | BEBXRVDHZDWBDL-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2nc(Cl)c(C#N)cc2c1Br |
|---|